C14H22BrNO — CID 63372756
(1R)-1-[3-bromo-4-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanol (PubChem CID 63372756) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is (1R)-1-[3-bromo-4-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanol.
| Compound Name | (1R)-1-[3-bromo-4-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 63372756 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (1R)-1-[3-bromo-4-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N(C)CC(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C14H22BrNO/c1-10(17)11-6-7-13(12(15)8-11)16(5)9-14(2,3)4/h6-8,10,17H,9H2,1-5H3/t10-/m1/s1 |
| InChIKey | RZJAPUZSMLLXEK-SNVBAGLBSA-N |
| XLogP | 3.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|