methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate

C14H16N2O2S — CID 63372924

IUPACmethyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(c2snc3ccccc23)CC1
InChIInChI=1S/C14H16N2O2S/c1-18-14(17)10-6-8-16(9-7-10)13-11-4-2-3-5-12(11)15-19-13/h2-5,10H,6-9H2,1H3
InChIKeyWZZSBHSSRBFIRE-UHFFFAOYSA-N
MW276.36 g/mol
LogP2.69
Rot. Bonds2

About methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate

methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate (PubChem CID 63372924) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate
PubChem CID63372924
Molecular FormulaC14H16N2O2S
Molecular Weight276.36 g/mol
Exact Mass276.09
IUPAC Namemethyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(c2snc3ccccc23)CC1
InChIInChI=1S/C14H16N2O2S/c1-18-14(17)10-6-8-16(9-7-10)13-11-4-2-3-5-12(11)15-19-13/h2-5,10H,6-9H2,1H3
InChIKeyWZZSBHSSRBFIRE-UHFFFAOYSA-N
XLogP2.69
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.36
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate (CID 63372924) is methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate is COC(=O)C1CCN(c2snc3ccccc23)CC1.
What is the InChIKey of methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate?
The InChIKey is WZZSBHSSRBFIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c1-18-14(17)10-6-8-16(9-7-10)13-11-4-2-3-5-12(11)15-19-13/h2-5,10H,6-9H2,1H3.
What are the key properties of methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate?
methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate has a molecular weight of 276.36 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2,1-benzothiazol-3-yl)piperidine-4-carboxylate is sourced from PubChem (CID 63372924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).