C13H14N2OS — CID 66353435
1-(2,1-benzothiazol-3-yl)piperidine-3-carbaldehyde (PubChem CID 66353435) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-(2,1-benzothiazol-3-yl)piperidine-3-carbaldehyde.
| Compound Name | 1-(2,1-benzothiazol-3-yl)piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 66353435 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(2,1-benzothiazol-3-yl)piperidine-3-carbaldehyde |
| SMILES | O=CC1CCCN(c2snc3ccccc23)C1 |
| InChI | InChI=1S/C13H14N2OS/c16-9-10-4-3-7-15(8-10)13-11-5-1-2-6-12(11)14-17-13/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | SPRMZSJDRKZRFC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|