C12H13ClN2S — CID 66356181
3-(4-chloropiperidin-1-yl)-2,1-benzothiazole (PubChem CID 66356181) has the molecular formula C12H13ClN2S and a molecular weight of 252.77 g/mol. Its IUPAC name is 3-(4-chloropiperidin-1-yl)-2,1-benzothiazole.
| Compound Name | 3-(4-chloropiperidin-1-yl)-2,1-benzothiazole |
|---|---|
| PubChem CID | 66356181 |
| Molecular Formula | C12H13ClN2S |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 3-(4-chloropiperidin-1-yl)-2,1-benzothiazole |
| SMILES | ClC1CCN(c2snc3ccccc23)CC1 |
| InChI | InChI=1S/C12H13ClN2S/c13-9-5-7-15(8-6-9)12-10-3-1-2-4-11(10)14-16-12/h1-4,9H,5-8H2 |
| InChIKey | BYNWKYHMQRKMMP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|