C13H16N2OS — CID 62814996
[1-(2,1-benzothiazol-3-yl)piperidin-3-yl]methanol (PubChem CID 62814996) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is [1-(2,1-benzothiazol-3-yl)piperidin-3-yl]methanol.
| Compound Name | [1-(2,1-benzothiazol-3-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 62814996 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [1-(2,1-benzothiazol-3-yl)piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2snc3ccccc23)C1 |
| InChI | InChI=1S/C13H16N2OS/c16-9-10-4-3-7-15(8-10)13-11-5-1-2-6-12(11)14-17-13/h1-2,5-6,10,16H,3-4,7-9H2 |
| InChIKey | LNSMCYXZSPBUOW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |