C15H19N3O3 — CID 63373773
3-methyl-N-[2-oxo-2-[(6-oxopiperidin-3-yl)amino]ethyl]benzamide (PubChem CID 63373773) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-methyl-N-[2-oxo-2-[(6-oxopiperidin-3-yl)amino]ethyl]benzamide.
| Compound Name | 3-methyl-N-[2-oxo-2-[(6-oxopiperidin-3-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 63373773 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-methyl-N-[2-oxo-2-[(6-oxopiperidin-3-yl)amino]ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCC(=O)NC2CCC(=O)NC2)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-10-3-2-4-11(7-10)15(21)17-9-14(20)18-12-5-6-13(19)16-8-12/h2-4,7,12H,5-6,8-9H2,1H3,(H,16,19)(H,17,21)(H,18,20) |
| InChIKey | RKJVPHGREDQKCD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |