C18H27N3 — CID 63373858
N,N-diethyl-2-[(2-methylpropylamino)methyl]quinolin-4-amine (PubChem CID 63373858) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N,N-diethyl-2-[(2-methylpropylamino)methyl]quinolin-4-amine.
| Compound Name | N,N-diethyl-2-[(2-methylpropylamino)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 63373858 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N,N-diethyl-2-[(2-methylpropylamino)methyl]quinolin-4-amine |
| SMILES | CCN(CC)c1cc(CNCC(C)C)nc2ccccc12 |
| InChI | InChI=1S/C18H27N3/c1-5-21(6-2)18-11-15(13-19-12-14(3)4)20-17-10-8-7-9-16(17)18/h7-11,14,19H,5-6,12-13H2,1-4H3 |
| InChIKey | OCWAEMFPKMJDAX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |