C18H27N3 — CID 63373896
2-[(tert-butylamino)methyl]-N,N-diethylquinolin-4-amine (PubChem CID 63373896) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-N,N-diethylquinolin-4-amine.
| Compound Name | 2-[(tert-butylamino)methyl]-N,N-diethylquinolin-4-amine |
|---|---|
| PubChem CID | 63373896 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-N,N-diethylquinolin-4-amine |
| SMILES | CCN(CC)c1cc(CNC(C)(C)C)nc2ccccc12 |
| InChI | InChI=1S/C18H27N3/c1-6-21(7-2)17-12-14(13-19-18(3,4)5)20-16-11-9-8-10-15(16)17/h8-12,19H,6-7,13H2,1-5H3 |
| InChIKey | WBJGDPPKBFKGPZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |