C14H17ClN2O — CID 63375545
2-[2-(chloromethyl)quinolin-4-yl]oxy-N,N-dimethylethanamine (PubChem CID 63375545) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 2-[2-(chloromethyl)quinolin-4-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[2-(chloromethyl)quinolin-4-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 63375545 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[2-(chloromethyl)quinolin-4-yl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cc(CCl)nc2ccccc12 |
| InChI | InChI=1S/C14H17ClN2O/c1-17(2)7-8-18-14-9-11(10-15)16-13-6-4-3-5-12(13)14/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | MMSIWUVDUBGABN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|