C16H10Cl3NO — CID 63446146
2-(chloromethyl)-4-(2,5-dichlorophenoxy)quinoline (PubChem CID 63446146) has the molecular formula C16H10Cl3NO and a molecular weight of 338.62 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(2,5-dichlorophenoxy)quinoline.
| Compound Name | 2-(chloromethyl)-4-(2,5-dichlorophenoxy)quinoline |
|---|---|
| PubChem CID | 63446146 |
| Molecular Formula | C16H10Cl3NO |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 2-(chloromethyl)-4-(2,5-dichlorophenoxy)quinoline |
| SMILES | ClCc1cc(Oc2cc(Cl)ccc2Cl)c2ccccc2n1 |
| InChI | InChI=1S/C16H10Cl3NO/c17-9-11-8-15(12-3-1-2-4-14(12)20-11)21-16-7-10(18)5-6-13(16)19/h1-8H,9H2 |
| InChIKey | UWTBRFCIDKGJTJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|