C8H7BrN2S2 — CID 63384084
2-bromo-5-(5-ethylthiophen-2-yl)-1,3,4-thiadiazole (PubChem CID 63384084) has the molecular formula C8H7BrN2S2 and a molecular weight of 275.20 g/mol. Its IUPAC name is 2-bromo-5-(5-ethylthiophen-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-(5-ethylthiophen-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63384084 |
| Molecular Formula | C8H7BrN2S2 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 273.92 |
| IUPAC Name | 2-bromo-5-(5-ethylthiophen-2-yl)-1,3,4-thiadiazole |
| SMILES | CCc1ccc(-c2nnc(Br)s2)s1 |
| InChI | InChI=1S/C8H7BrN2S2/c1-2-5-3-4-6(12-5)7-10-11-8(9)13-7/h3-4H,2H2,1H3 |
| InChIKey | ZFGPXRKVFIZNDZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |