C42H44S8Si3 — CID 101433570
bis[[5-[5-[5-(5-ethylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethylsilyl]-dimethylsilane (PubChem CID 101433570) has the molecular formula C42H44S8Si3 and a molecular weight of 889.61 g/mol. Its IUPAC name is bis[[5-[5-[5-(5-ethylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethylsilyl]-dimethylsilane.
| Compound Name | bis[[5-[5-[5-(5-ethylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethylsilyl]-dimethylsilane |
|---|---|
| PubChem CID | 101433570 |
| Molecular Formula | C42H44S8Si3 |
| Molecular Weight | 889.61 g/mol |
| Exact Mass | 888.05 |
| IUPAC Name | bis[[5-[5-[5-(5-ethylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-dimethylsilyl]-dimethylsilane |
| SMILES | CCc1ccc(-c2ccc(-c3ccc(-c4ccc([Si](C)(C)[Si](C)(C)[Si](C)(C)c5ccc(-c6ccc(-c7ccc(-c8ccc(CC)s8)s7)s6)s5)s4)s3)s2)s1 |
| InChI | InChI=1S/C42H44S8Si3/c1-9-27-11-13-29(43-27)31-15-17-33(45-31)35-19-21-37(47-35)39-23-25-41(49-39)51(3,4)53(7,8)52(5,6)42-26-24-40(50-42)38-22-20-36(48-38)34-18-16-32(46-34)30-14-12-28(10-2)44-30/h11-26H,9-10H2,1-8H3 |
| InChIKey | NBTICMLCBFANHV-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.61 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|