C7H10ClN3O — CID 63384863
3-chloro-4-(oxan-4-yl)-1,2,4-triazole (PubChem CID 63384863) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is 3-chloro-4-(oxan-4-yl)-1,2,4-triazole.
| Compound Name | 3-chloro-4-(oxan-4-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 63384863 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 3-chloro-4-(oxan-4-yl)-1,2,4-triazole |
| SMILES | Clc1nncn1C1CCOCC1 |
| InChI | InChI=1S/C7H10ClN3O/c8-7-10-9-5-11(7)6-1-3-12-4-2-6/h5-6H,1-4H2 |
| InChIKey | SHZDABNZOXYWSH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |