C7H11N3O2 — CID 156528223
4-(oxan-4-yl)-1H-1,2,4-triazol-5-one (PubChem CID 156528223) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 156528223 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]ncn1C1CCOCC1 |
| InChI | InChI=1S/C7H11N3O2/c11-7-9-8-5-10(7)6-1-3-12-4-2-6/h5-6H,1-4H2,(H,9,11) |
| InChIKey | QYDUBEJRIMOQPD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |