About 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one
4-(oxan-4-yl)-1H-1,2,4-triazol-5-one (PubChem CID 156528223) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one |
| PubChem CID | 156528223 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]ncn1C1CCOCC1 |
| InChI | InChI=1S/C7H11N3O2/c11-7-9-8-5-10(7)6-1-3-12-4-2-6/h5-6H,1-4H2,(H,9,11) |
| InChIKey | QYDUBEJRIMOQPD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one (CID 156528223) is 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one is O=c1[nH]ncn1C1CCOCC1.
What is the InChIKey of 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one?
The InChIKey is QYDUBEJRIMOQPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c11-7-9-8-5-10(7)6-1-3-12-4-2-6/h5-6H,1-4H2,(H,9,11).
What are the key properties of 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one?
4-(oxan-4-yl)-1H-1,2,4-triazol-5-one has a molecular weight of 169.18 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxan-4-yl)-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 156528223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).