C6H9N3OS — CID 80713989
4-(oxolan-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 80713989) has the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-(oxolan-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(oxolan-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 80713989 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-(oxolan-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1C1CCOC1 |
| InChI | InChI=1S/C6H9N3OS/c11-6-8-7-4-9(6)5-1-2-10-3-5/h4-5H,1-3H2,(H,8,11) |
| InChIKey | ZFIHVNYUNGBHJZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|