C11H11ClN2S — CID 63386259
2-chloro-5-[2-(3-methylphenyl)ethyl]-1,3,4-thiadiazole (PubChem CID 63386259) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 2-chloro-5-[2-(3-methylphenyl)ethyl]-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-[2-(3-methylphenyl)ethyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63386259 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-chloro-5-[2-(3-methylphenyl)ethyl]-1,3,4-thiadiazole |
| SMILES | Cc1cccc(CCc2nnc(Cl)s2)c1 |
| InChI | InChI=1S/C11H11ClN2S/c1-8-3-2-4-9(7-8)5-6-10-13-14-11(12)15-10/h2-4,7H,5-6H2,1H3 |
| InChIKey | LTNWTRTYSXIGKC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |