About N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide
N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide (PubChem CID 6338711) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide |
| PubChem CID | 6338711 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide |
| SMILES | C[C@H]1CCC/C(=N\NC(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H24N2O/c1-16-9-8-14-19(15-16)22-23-21(24)20(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13,16,20H,8-9,14-15H2,1H3,(H,23,24)/b22-19+/t16-/m0/s1 |
| InChIKey | LIGUGBCMTJASQI-QKDOTCOFSA-N |
| XLogP | 4.50 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide?
The IUPAC name of N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide (CID 6338711) is N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide.
What is the SMILES notation for N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide?
The canonical SMILES for N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide is C[C@H]1CCC/C(=N\NC(=O)C(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide?
The InChIKey is LIGUGBCMTJASQI-QKDOTCOFSA-N. The full InChI is InChI=1S/C21H24N2O/c1-16-9-8-14-19(15-16)22-23-21(24)20(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13,16,20H,8-9,14-15H2,1H3,(H,23,24)/b22-19+/t16-/m0/s1.
What are the key properties of N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide?
N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide has a molecular weight of 320.44 g/mol, XLogP of 4.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[(3S)-3-methylcyclohexylidene]amino]-2,2-diphenylacetamide is sourced from PubChem (CID 6338711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).