C20H22N2O — CID 968754
N-(cyclohexylideneamino)-2,2-diphenylacetamide (PubChem CID 968754) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-2,2-diphenylacetamide.
| Compound Name | N-(cyclohexylideneamino)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 968754 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-(cyclohexylideneamino)-2,2-diphenylacetamide |
| SMILES | O=C(NN=C1CCCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O/c23-20(22-21-18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-2,4-7,10-13,19H,3,8-9,14-15H2,(H,22,23) |
| InChIKey | BVWXJLCSPGLGRP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|