C15H18ClN3 — CID 63392510
1-[2-(2-chloroethyl)piperidin-1-yl]phthalazine (PubChem CID 63392510) has the molecular formula C15H18ClN3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 1-[2-(2-chloroethyl)piperidin-1-yl]phthalazine.
| Compound Name | 1-[2-(2-chloroethyl)piperidin-1-yl]phthalazine |
|---|---|
| PubChem CID | 63392510 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-[2-(2-chloroethyl)piperidin-1-yl]phthalazine |
| SMILES | ClCCC1CCCCN1c1nncc2ccccc12 |
| InChI | InChI=1S/C15H18ClN3/c16-9-8-13-6-3-4-10-19(13)15-14-7-2-1-5-12(14)11-17-18-15/h1-2,5,7,11,13H,3-4,6,8-10H2 |
| InChIKey | AWQAMPOVRFEQSV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|