C18H26ClNO — CID 63396240
(4-tert-butylphenyl)-[2-(3-chloropropyl)pyrrolidin-1-yl]methanone (PubChem CID 63396240) has the molecular formula C18H26ClNO and a molecular weight of 307.87 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[2-(3-chloropropyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[2-(3-chloropropyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 63396240 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (4-tert-butylphenyl)-[2-(3-chloropropyl)pyrrolidin-1-yl]methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCCC2CCCCl)cc1 |
| InChI | InChI=1S/C18H26ClNO/c1-18(2,3)15-10-8-14(9-11-15)17(21)20-13-5-7-16(20)6-4-12-19/h8-11,16H,4-7,12-13H2,1-3H3 |
| InChIKey | MFVGBCKSYVIUFA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|