C14H15ClF3NO — CID 65100163
[2-(3-chloropropyl)pyrrolidin-1-yl]-(2,4,6-trifluorophenyl)methanone (PubChem CID 65100163) has the molecular formula C14H15ClF3NO and a molecular weight of 305.73 g/mol. Its IUPAC name is [2-(3-chloropropyl)pyrrolidin-1-yl]-(2,4,6-trifluorophenyl)methanone.
| Compound Name | [2-(3-chloropropyl)pyrrolidin-1-yl]-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 65100163 |
| Molecular Formula | C14H15ClF3NO |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [2-(3-chloropropyl)pyrrolidin-1-yl]-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1c(F)cc(F)cc1F)N1CCCC1CCCCl |
| InChI | InChI=1S/C14H15ClF3NO/c15-5-1-3-10-4-2-6-19(10)14(20)13-11(17)7-9(16)8-12(13)18/h7-8,10H,1-6H2 |
| InChIKey | GMAPIFFEKYNGID-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|