C12H14Br2ClNOS — CID 107965902
[2-(3-chloropropyl)pyrrolidin-1-yl]-(2,5-dibromothiophen-3-yl)methanone (PubChem CID 107965902) has the molecular formula C12H14Br2ClNOS and a molecular weight of 415.58 g/mol. Its IUPAC name is [2-(3-chloropropyl)pyrrolidin-1-yl]-(2,5-dibromothiophen-3-yl)methanone.
| Compound Name | [2-(3-chloropropyl)pyrrolidin-1-yl]-(2,5-dibromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 107965902 |
| Molecular Formula | C12H14Br2ClNOS |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | [2-(3-chloropropyl)pyrrolidin-1-yl]-(2,5-dibromothiophen-3-yl)methanone |
| SMILES | O=C(c1cc(Br)sc1Br)N1CCCC1CCCCl |
| InChI | InChI=1S/C12H14Br2ClNOS/c13-10-7-9(11(14)18-10)12(17)16-6-2-4-8(16)3-1-5-15/h7-8H,1-6H2 |
| InChIKey | KLDCDEYYPAHIBT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|