C15H18BrFO — CID 63399488
2-[(2-bromo-5-fluorophenyl)methyl]-4-ethylcyclohexan-1-one (PubChem CID 63399488) has the molecular formula C15H18BrFO and a molecular weight of 313.21 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methyl]-4-ethylcyclohexan-1-one.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methyl]-4-ethylcyclohexan-1-one |
|---|---|
| PubChem CID | 63399488 |
| Molecular Formula | C15H18BrFO |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methyl]-4-ethylcyclohexan-1-one |
| SMILES | CCC1CCC(=O)C(Cc2cc(F)ccc2Br)C1 |
| InChI | InChI=1S/C15H18BrFO/c1-2-10-3-6-15(18)12(7-10)8-11-9-13(17)4-5-14(11)16/h4-5,9-10,12H,2-3,6-8H2,1H3 |
| InChIKey | WZKVFMKUWDVAII-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |