C16H21BrO2 — CID 65323404
2-[(2-bromo-5-methoxyphenyl)methyl]-4-ethylcyclohexan-1-one (PubChem CID 65323404) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 2-[(2-bromo-5-methoxyphenyl)methyl]-4-ethylcyclohexan-1-one.
| Compound Name | 2-[(2-bromo-5-methoxyphenyl)methyl]-4-ethylcyclohexan-1-one |
|---|---|
| PubChem CID | 65323404 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[(2-bromo-5-methoxyphenyl)methyl]-4-ethylcyclohexan-1-one |
| SMILES | CCC1CCC(=O)C(Cc2cc(OC)ccc2Br)C1 |
| InChI | InChI=1S/C16H21BrO2/c1-3-11-4-7-16(18)13(8-11)9-12-10-14(19-2)5-6-15(12)17/h5-6,10-11,13H,3-4,7-9H2,1-2H3 |
| InChIKey | MPDRTXLRJWWSOH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |