C22H24Br2O3 — CID 95387471
trans-(2S,6S)-2,6-bis[(2-bromo-5-methoxyphenyl)methyl]cyclohexan-1-one (PubChem CID 95387471) has the molecular formula C22H24Br2O3 and a molecular weight of 496.24 g/mol. Its IUPAC name is trans-(2S,6S)-2,6-bis[(2-bromo-5-methoxyphenyl)methyl]cyclohexan-1-one.
| Compound Name | trans-(2S,6S)-2,6-bis[(2-bromo-5-methoxyphenyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 95387471 |
| Molecular Formula | C22H24Br2O3 |
| Molecular Weight | 496.24 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | trans-(2S,6S)-2,6-bis[(2-bromo-5-methoxyphenyl)methyl]cyclohexan-1-one |
| SMILES | COc1ccc(Br)c(C[C@@H]2CCC[C@@H](Cc3cc(OC)ccc3Br)C2=O)c1 |
| InChI | InChI=1S/C22H24Br2O3/c1-26-18-6-8-20(23)16(12-18)10-14-4-3-5-15(22(14)25)11-17-13-19(27-2)7-9-21(17)24/h6-9,12-15H,3-5,10-11H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | NJPFJBIRBGBWBH-GJZGRUSLSA-N |
| XLogP | 6.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.24 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |