C15H21Cl2N — CID 63401428
1-cyclopropyl-3-(2,4-dichlorophenyl)-N-propylpropan-1-amine (PubChem CID 63401428) has the molecular formula C15H21Cl2N and a molecular weight of 286.25 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,4-dichlorophenyl)-N-propylpropan-1-amine.
| Compound Name | 1-cyclopropyl-3-(2,4-dichlorophenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 63401428 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-cyclopropyl-3-(2,4-dichlorophenyl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CCc1ccc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C15H21Cl2N/c1-2-9-18-15(12-3-4-12)8-6-11-5-7-13(16)10-14(11)17/h5,7,10,12,15,18H,2-4,6,8-9H2,1H3 |
| InChIKey | RDYDJOKUPQCSAA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |