About [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate
[(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate (PubChem CID 6340266) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate.
Molecular Properties
| Compound Name | [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate |
| PubChem CID | 6340266 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate |
| SMILES | C[C@H](S/C(=N/c1ccccc1)NC#N)c1ccccc1 |
| InChI | InChI=1S/C16H15N3S/c1-13(14-8-4-2-5-9-14)20-16(18-12-17)19-15-10-6-3-7-11-15/h2-11,13H,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | USIHRUMRXONVRV-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate?
The IUPAC name of [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate (CID 6340266) is [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate.
What is the SMILES notation for [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate?
The canonical SMILES for [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate is C[C@H](S/C(=N/c1ccccc1)NC#N)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate?
The InChIKey is USIHRUMRXONVRV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H15N3S/c1-13(14-8-4-2-5-9-14)20-16(18-12-17)19-15-10-6-3-7-11-15/h2-11,13H,1H3,(H,18,19)/t13-/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate?
[(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate has a molecular weight of 281.38 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] N-cyano-N'-phenylcarbamimidothioate is sourced from PubChem (CID 6340266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).