C18H25BrO2 — CID 63403119
1-[(3-bromophenyl)methyl]-4-butylcyclohexane-1-carboxylic acid (PubChem CID 63403119) has the molecular formula C18H25BrO2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-4-butylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(3-bromophenyl)methyl]-4-butylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63403119 |
| Molecular Formula | C18H25BrO2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-4-butylcyclohexane-1-carboxylic acid |
| SMILES | CCCCC1CCC(Cc2cccc(Br)c2)(C(=O)O)CC1 |
| InChI | InChI=1S/C18H25BrO2/c1-2-3-5-14-8-10-18(11-9-14,17(20)21)13-15-6-4-7-16(19)12-15/h4,6-7,12,14H,2-3,5,8-11,13H2,1H3,(H,20,21) |
| InChIKey | AFZFCHBCQIXZJL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |