C16H22O2 — CID 65393242
4-methyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 65393242) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-methyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-methyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65393242 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 4-methyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc(CC2(C(=O)O)CCC(C)CC2)c1 |
| InChI | InChI=1S/C16H22O2/c1-12-6-8-16(9-7-12,15(17)18)11-14-5-3-4-13(2)10-14/h3-5,10,12H,6-9,11H2,1-2H3,(H,17,18) |
| InChIKey | BJDDJETVEFCYQC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |