C21H37N — CID 142809981
ethane;ethene;N,N,4-trimethyl-1-[(3-methylphenyl)methyl]cyclohexan-1-amine (PubChem CID 142809981) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is ethane;ethene;N,N,4-trimethyl-1-[(3-methylphenyl)methyl]cyclohexan-1-amine.
| Compound Name | ethane;ethene;N,N,4-trimethyl-1-[(3-methylphenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 142809981 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | ethane;ethene;N,N,4-trimethyl-1-[(3-methylphenyl)methyl]cyclohexan-1-amine |
| SMILES | C=C.CC.Cc1cccc(CC2(N(C)C)CCC(C)CC2)c1 |
| InChI | InChI=1S/C17H27N.C2H6.C2H4/c1-14-8-10-17(11-9-14,18(3)4)13-16-7-5-6-15(2)12-16;2*1-2/h5-7,12,14H,8-11,13H2,1-4H3;1-2H3;1-2H2 |
| InChIKey | CSKDUKRGVFKNQY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|