C25H34N2OS — CID 11704258
2-benzylsulfanyl-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide (PubChem CID 11704258) has the molecular formula C25H34N2OS and a molecular weight of 410.63 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 11704258 |
| Molecular Formula | C25H34N2OS |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-benzylsulfanyl-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide |
| SMILES | Cc1cccc(CC2(N(C)C)CCC(NC(=O)CSCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H34N2OS/c1-20-8-7-11-22(16-20)17-25(27(2)3)14-12-23(13-15-25)26-24(28)19-29-18-21-9-5-4-6-10-21/h4-11,16,23H,12-15,17-19H2,1-3H3,(H,26,28) |
| InChIKey | COKKOSQWKFUHKU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |