C19H30N2OS — CID 75361908
N-[4-[(dimethylamino)methyl]cyclohexyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide (PubChem CID 75361908) has the molecular formula C19H30N2OS and a molecular weight of 334.53 g/mol. Its IUPAC name is N-[4-[(dimethylamino)methyl]cyclohexyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[4-[(dimethylamino)methyl]cyclohexyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 75361908 |
| Molecular Formula | C19H30N2OS |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[4-[(dimethylamino)methyl]cyclohexyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cccc(CSCC(=O)NC2CCC(CN(C)C)CC2)c1 |
| InChI | InChI=1S/C19H30N2OS/c1-15-5-4-6-17(11-15)13-23-14-19(22)20-18-9-7-16(8-10-18)12-21(2)3/h4-6,11,16,18H,7-10,12-14H2,1-3H3,(H,20,22) |
| InChIKey | XRHFFCWTUDAOJN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |