C24H31ClN2O2 — CID 11676011
2-(3-chlorophenoxy)-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide (PubChem CID 11676011) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 11676011 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[4-(dimethylamino)-4-[(3-methylphenyl)methyl]cyclohexyl]acetamide |
| SMILES | Cc1cccc(CC2(N(C)C)CCC(NC(=O)COc3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C24H31ClN2O2/c1-18-6-4-7-19(14-18)16-24(27(2)3)12-10-21(11-13-24)26-23(28)17-29-22-9-5-8-20(25)15-22/h4-9,14-15,21H,10-13,16-17H2,1-3H3,(H,26,28) |
| InChIKey | VFNNBNRYSJGXPZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |