C19H29NS — CID 63404643
(2-cyclohexylsulfanyl-4-phenylcyclohexyl)methanamine (PubChem CID 63404643) has the molecular formula C19H29NS and a molecular weight of 303.51 g/mol. Its IUPAC name is (2-cyclohexylsulfanyl-4-phenylcyclohexyl)methanamine.
| Compound Name | (2-cyclohexylsulfanyl-4-phenylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 63404643 |
| Molecular Formula | C19H29NS |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (2-cyclohexylsulfanyl-4-phenylcyclohexyl)methanamine |
| SMILES | NCC1CCC(c2ccccc2)CC1SC1CCCCC1 |
| InChI | InChI=1S/C19H29NS/c20-14-17-12-11-16(15-7-3-1-4-8-15)13-19(17)21-18-9-5-2-6-10-18/h1,3-4,7-8,16-19H,2,5-6,9-14,20H2 |
| InChIKey | JCJFNEOSTVKZTC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |