C15H27N3O — CID 63406023
2-N-butan-2-yl-2-N-butyl-6-ethoxypyridine-2,5-diamine (PubChem CID 63406023) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-N-butan-2-yl-2-N-butyl-6-ethoxypyridine-2,5-diamine.
| Compound Name | 2-N-butan-2-yl-2-N-butyl-6-ethoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 63406023 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2-N-butan-2-yl-2-N-butyl-6-ethoxypyridine-2,5-diamine |
| SMILES | CCCCN(c1ccc(N)c(OCC)n1)C(C)CC |
| InChI | InChI=1S/C15H27N3O/c1-5-8-11-18(12(4)6-2)14-10-9-13(16)15(17-14)19-7-3/h9-10,12H,5-8,11,16H2,1-4H3 |
| InChIKey | IAFKBJMQENIVJA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |