C12H22N4 — CID 80647917
2-N-butan-2-yl-2-N-butylpyrazine-2,6-diamine (PubChem CID 80647917) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-N-butan-2-yl-2-N-butylpyrazine-2,6-diamine.
| Compound Name | 2-N-butan-2-yl-2-N-butylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80647917 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-N-butan-2-yl-2-N-butylpyrazine-2,6-diamine |
| SMILES | CCCCN(c1cncc(N)n1)C(C)CC |
| InChI | InChI=1S/C12H22N4/c1-4-6-7-16(10(3)5-2)12-9-14-8-11(13)15-12/h8-10H,4-7H2,1-3H3,(H2,13,15) |
| InChIKey | STZROOHVYLYGMA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |