C16H20BrF3O — CID 63409821
1-[4-bromo-2-(trifluoromethyl)phenyl]-3-ethylheptan-1-one (PubChem CID 63409821) has the molecular formula C16H20BrF3O and a molecular weight of 365.23 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]-3-ethylheptan-1-one.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-3-ethylheptan-1-one |
|---|---|
| PubChem CID | 63409821 |
| Molecular Formula | C16H20BrF3O |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-3-ethylheptan-1-one |
| SMILES | CCCCC(CC)CC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C16H20BrF3O/c1-3-5-6-11(4-2)9-15(21)13-8-7-12(17)10-14(13)16(18,19)20/h7-8,10-11H,3-6,9H2,1-2H3 |
| InChIKey | AKFXRSARNXNWMQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |