C10H19N3S2 — CID 6341027
[(E)-[(2S,3R,6R)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]thiourea (PubChem CID 6341027) has the molecular formula C10H19N3S2 and a molecular weight of 245.42 g/mol. Its IUPAC name is [(E)-[(2S,3R,6R)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]thiourea.
| Compound Name | [(E)-[(2S,3R,6R)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 6341027 |
| Molecular Formula | C10H19N3S2 |
| Molecular Weight | 245.42 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [(E)-[(2S,3R,6R)-2-ethyl-3,6-dimethylthian-4-ylidene]amino]thiourea |
| SMILES | CC[C@@H]1S[C@H](C)C/C(=N\NC(N)=S)[C@H]1C |
| InChI | InChI=1S/C10H19N3S2/c1-4-9-7(3)8(5-6(2)15-9)12-13-10(11)14/h6-7,9H,4-5H2,1-3H3,(H3,11,13,14)/b12-8+/t6-,7-,9+/m1/s1 |
| InChIKey | UAUHIFSBKYNFHU-VBZPJYSESA-N |
| XLogP | 2.12 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|