C19H10F4N4O2 — CID 634105
ethyl 8,9,10,11-tetrafluoro-2,3,13,20-tetrazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(20),3,5,7(12),8,10,14,16,18-nonaene-5-carboxylate (PubChem CID 634105) has the molecular formula C19H10F4N4O2 and a molecular weight of 402.31 g/mol. Its IUPAC name is ethyl 8,9,10,11-tetrafluoro-2,3,13,20-tetrazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(20),3,5,7(12),8,10,14,16,18-nonaene-5-carboxylate.
| Compound Name | ethyl 8,9,10,11-tetrafluoro-2,3,13,20-tetrazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(20),3,5,7(12),8,10,14,16,18-nonaene-5-carboxylate |
|---|---|
| PubChem CID | 634105 |
| Molecular Formula | C19H10F4N4O2 |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | ethyl 8,9,10,11-tetrafluoro-2,3,13,20-tetrazapentacyclo[11.7.0.02,6.07,12.014,19]icosa-1(20),3,5,7(12),8,10,14,16,18-nonaene-5-carboxylate |
| SMILES | CCOC(=O)c1cnn2c1c1c(F)c(F)c(F)c(F)c1n1c3ccccc3nc21 |
| InChI | InChI=1S/C19H10F4N4O2/c1-2-29-18(28)8-7-24-27-16(8)11-12(20)13(21)14(22)15(23)17(11)26-10-6-4-3-5-9(10)25-19(26)27/h3-7H,2H2,1H3 |
| InChIKey | FKFNHOLZGBUQJG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|