C22H22N6O2 — CID 634108
7-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]-3-phenylchromen-2-one (PubChem CID 634108) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 7-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]-3-phenylchromen-2-one.
| Compound Name | 7-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 634108 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 7-[[4-amino-6-(diethylamino)-1,3,5-triazin-2-yl]amino]-3-phenylchromen-2-one |
| SMILES | CCN(CC)c1nc(N)nc(Nc2ccc3cc(-c4ccccc4)c(=O)oc3c2)n1 |
| InChI | InChI=1S/C22H22N6O2/c1-3-28(4-2)22-26-20(23)25-21(27-22)24-16-11-10-15-12-17(14-8-6-5-7-9-14)19(29)30-18(15)13-16/h5-13H,3-4H2,1-2H3,(H3,23,24,25,26,27) |
| InChIKey | JSKFNGJACACSEY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|