C18H27NO2 — CID 63418869
N-(2,4-dimethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine (PubChem CID 63418869) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 63418869 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
| SMILES | COc1ccc(NC2CC3CCC2(C)C3(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H27NO2/c1-17(2)12-8-9-18(17,3)16(10-12)19-14-7-6-13(20-4)11-15(14)21-5/h6-7,11-12,16,19H,8-10H2,1-5H3 |
| InChIKey | KJTNIGSJTZDZSM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|