C16H25NO2 — CID 64774711
N-(2,5-dimethylcyclohexyl)-2,4-dimethoxyaniline (PubChem CID 64774711) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(2,5-dimethylcyclohexyl)-2,4-dimethoxyaniline.
| Compound Name | N-(2,5-dimethylcyclohexyl)-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 64774711 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-(2,5-dimethylcyclohexyl)-2,4-dimethoxyaniline |
| SMILES | COc1ccc(NC2CC(C)CCC2C)c(OC)c1 |
| InChI | InChI=1S/C16H25NO2/c1-11-5-6-12(2)15(9-11)17-14-8-7-13(18-3)10-16(14)19-4/h7-8,10-12,15,17H,5-6,9H2,1-4H3 |
| InChIKey | PBBBLBUUPNBKEH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|