C14H19FIN — CID 79769375
N-(2,5-dimethylcyclohexyl)-4-fluoro-2-iodoaniline (PubChem CID 79769375) has the molecular formula C14H19FIN and a molecular weight of 347.22 g/mol. Its IUPAC name is N-(2,5-dimethylcyclohexyl)-4-fluoro-2-iodoaniline.
| Compound Name | N-(2,5-dimethylcyclohexyl)-4-fluoro-2-iodoaniline |
|---|---|
| PubChem CID | 79769375 |
| Molecular Formula | C14H19FIN |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(2,5-dimethylcyclohexyl)-4-fluoro-2-iodoaniline |
| SMILES | CC1CCC(C)C(Nc2ccc(F)cc2I)C1 |
| InChI | InChI=1S/C14H19FIN/c1-9-3-4-10(2)14(7-9)17-13-6-5-11(15)8-12(13)16/h5-6,8-10,14,17H,3-4,7H2,1-2H3 |
| InChIKey | RXIARJPOOMUFOC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|