C15H14Br3N — CID 63425110
2,4,6-tribromo-N-[(2,5-dimethylphenyl)methyl]aniline (PubChem CID 63425110) has the molecular formula C15H14Br3N and a molecular weight of 448.00 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[(2,5-dimethylphenyl)methyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[(2,5-dimethylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 63425110 |
| Molecular Formula | C15H14Br3N |
| Molecular Weight | 448.00 g/mol |
| Exact Mass | 444.87 |
| IUPAC Name | 2,4,6-tribromo-N-[(2,5-dimethylphenyl)methyl]aniline |
| SMILES | Cc1ccc(C)c(CNc2c(Br)cc(Br)cc2Br)c1 |
| InChI | InChI=1S/C15H14Br3N/c1-9-3-4-10(2)11(5-9)8-19-15-13(17)6-12(16)7-14(15)18/h3-7,19H,8H2,1-2H3 |
| InChIKey | NRPSGYRODZNHBT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.00 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |