C15H15F2N — CID 60687426
N-[(2,5-dimethylphenyl)methyl]-2,6-difluoroaniline (PubChem CID 60687426) has the molecular formula C15H15F2N and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-2,6-difluoroaniline.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 60687426 |
| Molecular Formula | C15H15F2N |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-2,6-difluoroaniline |
| SMILES | Cc1ccc(C)c(CNc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C15H15F2N/c1-10-6-7-11(2)12(8-10)9-18-15-13(16)4-3-5-14(15)17/h3-8,18H,9H2,1-2H3 |
| InChIKey | RKHXGOPRAXQIED-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |