C15H15FN2O2 — CID 81310984
N-[(2,5-dimethylphenyl)methyl]-2-fluoro-6-nitroaniline (PubChem CID 81310984) has the molecular formula C15H15FN2O2 and a molecular weight of 274.30 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-2-fluoro-6-nitroaniline.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-2-fluoro-6-nitroaniline |
|---|---|
| PubChem CID | 81310984 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-2-fluoro-6-nitroaniline |
| SMILES | Cc1ccc(C)c(CNc2c(F)cccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15FN2O2/c1-10-6-7-11(2)12(8-10)9-17-15-13(16)4-3-5-14(15)18(19)20/h3-8,17H,9H2,1-2H3 |
| InChIKey | WUIRMISTKMHMKT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|