C14H10BrCl4N — CID 63425757
4-bromo-2,6-dichloro-N-[1-(3,4-dichlorophenyl)ethyl]aniline (PubChem CID 63425757) has the molecular formula C14H10BrCl4N and a molecular weight of 413.96 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[1-(3,4-dichlorophenyl)ethyl]aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-[1-(3,4-dichlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 63425757 |
| Molecular Formula | C14H10BrCl4N |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[1-(3,4-dichlorophenyl)ethyl]aniline |
| SMILES | CC(Nc1c(Cl)cc(Br)cc1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10BrCl4N/c1-7(8-2-3-10(16)11(17)4-8)20-14-12(18)5-9(15)6-13(14)19/h2-7,20H,1H3 |
| InChIKey | LEGKKHURUKHCIC-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |