C20H26O — CID 63426066
2-methyl-2-phenyl-1-(2,3,5,6-tetramethylphenyl)propan-1-ol (PubChem CID 63426066) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-methyl-2-phenyl-1-(2,3,5,6-tetramethylphenyl)propan-1-ol.
| Compound Name | 2-methyl-2-phenyl-1-(2,3,5,6-tetramethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 63426066 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2-methyl-2-phenyl-1-(2,3,5,6-tetramethylphenyl)propan-1-ol |
| SMILES | Cc1cc(C)c(C)c(C(O)C(C)(C)c2ccccc2)c1C |
| InChI | InChI=1S/C20H26O/c1-13-12-14(2)16(4)18(15(13)3)19(21)20(5,6)17-10-8-7-9-11-17/h7-12,19,21H,1-6H3 |
| InChIKey | HMSFGCHYWWNZQR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |