C19H21N4OS+ — CID 6342616
[[2-benzoyl-4-(dimethylamino)thieno[2,3-b]pyridin-3-yl]amino]methylidene-dimethylazanium (PubChem CID 6342616) has the molecular formula C19H21N4OS+ and a molecular weight of 353.47 g/mol. Its IUPAC name is [[2-benzoyl-4-(dimethylamino)thieno[2,3-b]pyridin-3-yl]amino]methylidene-dimethylazanium.
| Compound Name | [[2-benzoyl-4-(dimethylamino)thieno[2,3-b]pyridin-3-yl]amino]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 6342616 |
| Molecular Formula | C19H21N4OS+ |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [[2-benzoyl-4-(dimethylamino)thieno[2,3-b]pyridin-3-yl]amino]methylidene-dimethylazanium |
| SMILES | CN(C)c1ccnc2sc(C(=O)c3ccccc3)c(NC=[N+](C)C)c12 |
| InChI | InChI=1S/C19H20N4OS/c1-22(2)12-21-16-15-14(23(3)4)10-11-20-19(15)25-18(16)17(24)13-8-6-5-7-9-13/h5-12H,1-4H3/p+1 |
| InChIKey | QWCQBDVIOBSXCW-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|