C27H31N7O3S2 — CID 160525183
13-(dimethylamino)-5-methyl-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;methyl 4-(dimethylamino)-3-(dimethylaminomethylideneamino)thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 160525183) has the molecular formula C27H31N7O3S2 and a molecular weight of 565.73 g/mol. Its IUPAC name is 13-(dimethylamino)-5-methyl-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;methyl 4-(dimethylamino)-3-(dimethylaminomethylideneamino)thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | 13-(dimethylamino)-5-methyl-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;methyl 4-(dimethylamino)-3-(dimethylaminomethylideneamino)thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 160525183 |
| Molecular Formula | C27H31N7O3S2 |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 13-(dimethylamino)-5-methyl-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;methyl 4-(dimethylamino)-3-(dimethylaminomethylideneamino)thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CN(C)c1ccnc2sc3c(=O)n(C)ccc3c12.COC(=O)c1sc2nccc(N(C)C)c2c1/N=C/N(C)C |
| InChI | InChI=1S/C14H18N4O2S.C13H13N3OS/c1-17(2)8-16-11-10-9(18(3)4)6-7-15-13(10)21-12(11)14(19)20-5;1-15(2)9-4-6-14-12-10(9)8-5-7-16(3)13(17)11(8)18-12/h6-8H,1-5H3;4-7H,1-3H3/b16-8+; |
| InChIKey | QUUHZMGXSHPHHB-OHGISNTKSA-N |
| XLogP | 4.58 |
| TPSA | 96.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|